C20H12F5N4O3S2- — CID 140599848
(1Z)-N-[4-[2,4-difluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxothieno[2,3-d]pyrimidin-5-yl)ethanimidate (PubChem CID 140599848) has the molecular formula C20H12F5N4O3S2- and a molecular weight of 515.47 g/mol. Its IUPAC name is (1Z)-N-[4-[2,4-difluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxothieno[2,3-d]pyrimidin-5-yl)ethanimidate.
| Compound Name | (1Z)-N-[4-[2,4-difluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxothieno[2,3-d]pyrimidin-5-yl)ethanimidate |
|---|---|
| PubChem CID | 140599848 |
| Molecular Formula | C20H12F5N4O3S2- |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | (1Z)-N-[4-[2,4-difluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-2-(1,3-dimethyl-2,4-dioxothieno[2,3-d]pyrimidin-5-yl)ethanimidate |
| SMILES | Cn1c(=O)c2c(C/C([O-])=N/c3nc(-c4ccc(F)c(C(F)(F)F)c4F)cs3)csc2n(C)c1=O |
| InChI | InChI=1S/C20H13F5N4O3S2/c1-28-16(31)13-8(6-33-17(13)29(2)19(28)32)5-12(30)27-18-26-11(7-34-18)9-3-4-10(21)14(15(9)22)20(23,24)25/h3-4,6-7H,5H2,1-2H3,(H,26,27,30)/p-1 |
| InChIKey | XOPMVFNBFICPDB-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|