potassium trifluoromethane

CF3K — CID 140600404

IUPACpotassium trifluoromethane
SMILESF[C-](F)F.[K+]
InChIInChI=1S/CF3.K/c2-1(3)4;/q-1;+1
InChIKeyHBSUGAYDWVPOOM-UHFFFAOYSA-N
MW108.10 g/mol
LogP-1.65
Rot. Bonds

About potassium trifluoromethane

potassium trifluoromethane (PubChem CID 140600404) has the molecular formula CF3K and a molecular weight of 108.10 g/mol. Its IUPAC name is potassium trifluoromethane.

Molecular Properties

Compound Namepotassium trifluoromethane
PubChem CID140600404
Molecular FormulaCF3K
Molecular Weight108.10 g/mol
Exact Mass107.96
IUPAC Namepotassium trifluoromethane
SMILESF[C-](F)F.[K+]
InChIInChI=1S/CF3.K/c2-1(3)4;/q-1;+1
InChIKeyHBSUGAYDWVPOOM-UHFFFAOYSA-N
XLogP-1.65
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.10
LogP ≤ 5-1.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze potassium trifluoromethane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium trifluoromethane?
The IUPAC name of potassium trifluoromethane (CID 140600404) is potassium trifluoromethane.
What is the SMILES notation for potassium trifluoromethane?
The canonical SMILES for potassium trifluoromethane is F[C-](F)F.[K+].
What is the InChIKey of potassium trifluoromethane?
The InChIKey is HBSUGAYDWVPOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/CF3.K/c2-1(3)4;/q-1;+1.
What are the key properties of potassium trifluoromethane?
potassium trifluoromethane has a molecular weight of 108.10 g/mol, XLogP of -1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoromethane is sourced from PubChem (CID 140600404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).