C31H19LiN3O+ — CID 140600458
lithium 5-(4-pyrimidin-5-ylbenzo[a]anthracen-7-yl)quinolin-1-ium-8-olate (PubChem CID 140600458) has the molecular formula C31H19LiN3O+ and a molecular weight of 456.45 g/mol. Its IUPAC name is lithium 5-(4-pyrimidin-5-ylbenzo[a]anthracen-7-yl)quinolin-1-ium-8-olate.
| Compound Name | lithium 5-(4-pyrimidin-5-ylbenzo[a]anthracen-7-yl)quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600458 |
| Molecular Formula | C31H19LiN3O+ |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | lithium 5-(4-pyrimidin-5-ylbenzo[a]anthracen-7-yl)quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2c3ccccc3cc3c2ccc2c(-c4cncnc4)cccc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C31H19N3O.Li/c35-29-13-12-25(27-9-4-14-34-31(27)29)30-22-6-2-1-5-19(22)15-28-23-8-3-7-21(20-16-32-18-33-17-20)24(23)10-11-26(28)30;/h1-18,35H;/q;+1 |
| InChIKey | IFBNXQUNAGCSFA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|