C42H27LiN3O+ — CID 140600459
lithium 5-[5-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-1-yl]quinolin-1-ium-8-olate (PubChem CID 140600459) has the molecular formula C42H27LiN3O+ and a molecular weight of 596.64 g/mol. Its IUPAC name is lithium 5-[5-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-1-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[5-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-1-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600459 |
| Molecular Formula | C42H27LiN3O+ |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | lithium 5-[5-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-1-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2cccc3cc4c(-c5ccc(-c6nc7ccccc7n6-c6ccccc6)cc5)cccc4cc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C42H27N3O.Li/c46-40-23-22-34(35-15-8-24-43-41(35)40)33-14-7-10-30-25-36-29(26-37(30)33)9-6-13-32(36)27-18-20-28(21-19-27)42-44-38-16-4-5-17-39(38)45(42)31-11-2-1-3-12-31;/h1-26,46H;/q;+1 |
| InChIKey | ZIIASWSCJKNQPF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|