C42H26LiN4O+ — CID 140600489
lithium 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate (PubChem CID 140600489) has the molecular formula C42H26LiN4O+ and a molecular weight of 609.64 g/mol. Its IUPAC name is lithium 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600489 |
| Molecular Formula | C42H26LiN4O+ |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | lithium 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1c(-c2c3ccccc3cc3c2ccc2c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc23)ccc2ccc[nH+]c12 |
| InChI | InChI=1S/C42H26N4O.Li/c47-39-35(21-20-26-16-10-24-43-38(26)39)37-30-17-8-7-15-29(30)25-36-31-18-9-19-34(32(31)22-23-33(36)37)42-45-40(27-11-3-1-4-12-27)44-41(46-42)28-13-5-2-6-14-28;/h1-25,47H;/q;+1 |
| InChIKey | UWADBRZWEBUWLV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|