About [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium
[4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium (PubChem CID 140600608) has the molecular formula C36H31O2S2+
and a molecular weight of 559.78 g/mol. Its IUPAC name is [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium.
Molecular Properties
| Compound Name | [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium |
| PubChem CID | 140600608 |
| Molecular Formula | C36H31O2S2+ |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium |
| SMILES | CCOc1c2ccccc2c(OCC)c2cc(Sc3ccc([S+](c4ccccc4)c4ccccc4)cc3)ccc12 |
| InChI | InChI=1S/C36H31O2S2/c1-3-37-35-31-17-11-12-18-32(31)36(38-4-2)34-25-27(21-24-33(34)35)39-26-19-22-30(23-20-26)40(28-13-7-5-8-14-28)29-15-9-6-10-16-29/h5-25H,3-4H2,1-2H3/q+1 |
| InChIKey | XLYHIUUTESRQAP-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium?
The IUPAC name of [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium (CID 140600608) is [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium.
What is the SMILES notation for [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium?
The canonical SMILES for [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium is CCOc1c2ccccc2c(OCC)c2cc(Sc3ccc([S+](c4ccccc4)c4ccccc4)cc3)ccc12.
What is the InChIKey of [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium?
The InChIKey is XLYHIUUTESRQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H31O2S2/c1-3-37-35-31-17-11-12-18-32(31)36(38-4-2)34-25-27(21-24-33(34)35)39-26-19-22-30(23-20-26)40(28-13-7-5-8-14-28)29-15-9-6-10-16-29/h5-25H,3-4H2,1-2H3/q+1.
What are the key properties of [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium?
[4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium has a molecular weight of 559.78 g/mol, XLogP of 10.04, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(9,10-diethoxyanthracen-2-yl)sulfanylphenyl]-diphenylsulfanium is sourced from PubChem (CID 140600608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).