About 2-methylquinazoline;platinum
2-methylquinazoline;platinum (PubChem CID 140601163) has the molecular formula C9H8N2Pt
and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-methylquinazoline;platinum.
Molecular Properties
| Compound Name | 2-methylquinazoline;platinum |
| PubChem CID | 140601163 |
| Molecular Formula | C9H8N2Pt |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-methylquinazoline;platinum |
| SMILES | Cc1ncc2ccccc2n1.[Pt] |
| InChI | InChI=1S/C9H8N2.Pt/c1-7-10-6-8-4-2-3-5-9(8)11-7;/h2-6H,1H3; |
| InChIKey | IOZOLOVRPPTFKM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylquinazoline;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinazoline;platinum?
The IUPAC name of 2-methylquinazoline;platinum (CID 140601163) is 2-methylquinazoline;platinum.
What is the SMILES notation for 2-methylquinazoline;platinum?
The canonical SMILES for 2-methylquinazoline;platinum is Cc1ncc2ccccc2n1.[Pt].
What is the InChIKey of 2-methylquinazoline;platinum?
The InChIKey is IOZOLOVRPPTFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.Pt/c1-7-10-6-8-4-2-3-5-9(8)11-7;/h2-6H,1H3;.
What are the key properties of 2-methylquinazoline;platinum?
2-methylquinazoline;platinum has a molecular weight of 339.26 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinazoline;platinum is sourced from PubChem (CID 140601163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).