C34H24N4 — CID 140601176
2-[2-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-9H-fluoren-9-yl]-9-pyridin-2-ylcarbazole (PubChem CID 140601176) has the molecular formula C34H24N4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[2-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-9H-fluoren-9-yl]-9-pyridin-2-ylcarbazole.
| Compound Name | 2-[2-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-9H-fluoren-9-yl]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 140601176 |
| Molecular Formula | C34H24N4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-[2-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-9H-fluoren-9-yl]-9-pyridin-2-ylcarbazole |
| SMILES | C[n+]1[c-]n(-c2ccc3c(c2)C(c2ccc4c5ccccc5n(-c5ccccn5)c4c2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C34H24N4/c1-36-18-19-37(22-36)24-14-16-26-25-8-2-3-10-29(25)34(30(26)21-24)23-13-15-28-27-9-4-5-11-31(27)38(32(28)20-23)33-12-6-7-17-35-33/h2-21,34H,1H3 |
| InChIKey | PXXYCFHZMBBHSH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|