C15H12Cl2N4OS — CID 140601623
N-(4-amino-2,6-dichloro-3,5-dimethylphenyl)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 140601623) has the molecular formula C15H12Cl2N4OS and a molecular weight of 367.26 g/mol. Its IUPAC name is N-(4-amino-2,6-dichloro-3,5-dimethylphenyl)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | N-(4-amino-2,6-dichloro-3,5-dimethylphenyl)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 140601623 |
| Molecular Formula | C15H12Cl2N4OS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-(4-amino-2,6-dichloro-3,5-dimethylphenyl)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | Cc1c(N)c(C)c(Cl)c(NC(=O)c2csc3cncnc23)c1Cl |
| InChI | InChI=1S/C15H12Cl2N4OS/c1-6-10(16)14(11(17)7(2)12(6)18)21-15(22)8-4-23-9-3-19-5-20-13(8)9/h3-5H,18H2,1-2H3,(H,21,22) |
| InChIKey | JILIIAUYBPZNMU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|