About fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine
fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine (PubChem CID 140602416) has the molecular formula C23H20FN3O3PdS
and a molecular weight of 543.92 g/mol. Its IUPAC name is fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine.
Molecular Properties
| Compound Name | fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine |
| PubChem CID | 140602416 |
| Molecular Formula | C23H20FN3O3PdS |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine |
| SMILES | COc1ccc(S(=O)(=O)[N-]c2ccccc2-c2ccccn2)cc1.F[Pd+].c1ccncc1 |
| InChI | InChI=1S/C18H15N2O3S.C5H5N.FH.Pd/c1-23-14-9-11-15(12-10-14)24(21,22)20-18-8-3-2-6-16(18)17-7-4-5-13-19-17;1-2-4-6-5-3-1;;/h2-13H,1H3;1-5H;1H;/q-1;;;+2/p-1 |
| InChIKey | SJLXNTCGJPVQPG-UHFFFAOYSA-M |
| XLogP | 5.65 |
| TPSA | 83.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
The IUPAC name of fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine (CID 140602416) is fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine.
What is the SMILES notation for fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
The canonical SMILES for fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine is COc1ccc(S(=O)(=O)[N-]c2ccccc2-c2ccccn2)cc1.F[Pd+].c1ccncc1.
What is the InChIKey of fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
The InChIKey is SJLXNTCGJPVQPG-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15N2O3S.C5H5N.FH.Pd/c1-23-14-9-11-15(12-10-14)24(21,22)20-18-8-3-2-6-16(18)17-7-4-5-13-19-17;1-2-4-6-5-3-1;;/h2-13H,1H3;1-5H;1H;/q-1;;;+2/p-1.
What are the key properties of fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine has a molecular weight of 543.92 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluoropalladium(1+);(4-methoxyphenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine is sourced from PubChem (CID 140602416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).