About 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene
5-tert-butyl-6-methyl-2,3-dihydro-1H-indene (PubChem CID 140602507) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 140602507 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene |
| SMILES | Cc1cc2c(cc1C(C)(C)C)CCC2 |
| InChI | InChI=1S/C14H20/c1-10-8-11-6-5-7-12(11)9-13(10)14(2,3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | LAVLIHXQRGIRJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene?
The IUPAC name of 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene (CID 140602507) is 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene is Cc1cc2c(cc1C(C)(C)C)CCC2.
What is the InChIKey of 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene?
The InChIKey is LAVLIHXQRGIRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-10-8-11-6-5-7-12(11)9-13(10)14(2,3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene?
5-tert-butyl-6-methyl-2,3-dihydro-1H-indene has a molecular weight of 188.31 g/mol, XLogP of 3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-6-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 140602507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).