C22H18F5N5 — CID 140602558
4-[[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]imino]-1,1,1-trifluorobut-2-en-2-amine (PubChem CID 140602558) has the molecular formula C22H18F5N5 and a molecular weight of 447.41 g/mol. Its IUPAC name is 4-[[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]imino]-1,1,1-trifluorobut-2-en-2-amine.
| Compound Name | 4-[[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]imino]-1,1,1-trifluorobut-2-en-2-amine |
|---|---|
| PubChem CID | 140602558 |
| Molecular Formula | C22H18F5N5 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-[[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]imino]-1,1,1-trifluorobut-2-en-2-amine |
| SMILES | CC(C)(c1cccc(N=CC=C(N)C(F)(F)F)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C22H18F5N5/c1-21(2,16-6-3-5-14(30-16)13-9-10-18(23)32-20(13)24)17-7-4-8-19(31-17)29-12-11-15(28)22(25,26)27/h3-12H,28H2,1-2H3 |
| InChIKey | MIRUJKCASLZGEE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|