About 2-hydroxy-3,4-dihydropyrido[3,4-b]indole
2-hydroxy-3,4-dihydropyrido[3,4-b]indole (PubChem CID 14060368) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-hydroxy-3,4-dihydropyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 2-hydroxy-3,4-dihydropyrido[3,4-b]indole |
| PubChem CID | 14060368 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-hydroxy-3,4-dihydropyrido[3,4-b]indole |
| SMILES | ON1C=C2N=c3ccccc3=C2CC1 |
| InChI | InChI=1S/C11H10N2O/c14-13-6-5-9-8-3-1-2-4-10(8)12-11(9)7-13/h1-4,7,14H,5-6H2 |
| InChIKey | FAJGQFVVBIDJHX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-3,4-dihydropyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,4-dihydropyrido[3,4-b]indole?
The IUPAC name of 2-hydroxy-3,4-dihydropyrido[3,4-b]indole (CID 14060368) is 2-hydroxy-3,4-dihydropyrido[3,4-b]indole.
What is the SMILES notation for 2-hydroxy-3,4-dihydropyrido[3,4-b]indole?
The canonical SMILES for 2-hydroxy-3,4-dihydropyrido[3,4-b]indole is ON1C=C2N=c3ccccc3=C2CC1.
What is the InChIKey of 2-hydroxy-3,4-dihydropyrido[3,4-b]indole?
The InChIKey is FAJGQFVVBIDJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c14-13-6-5-9-8-3-1-2-4-10(8)12-11(9)7-13/h1-4,7,14H,5-6H2.
What are the key properties of 2-hydroxy-3,4-dihydropyrido[3,4-b]indole?
2-hydroxy-3,4-dihydropyrido[3,4-b]indole has a molecular weight of 186.21 g/mol, XLogP of 0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,4-dihydropyrido[3,4-b]indole is sourced from PubChem (CID 14060368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).