About 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate
2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate (PubChem CID 140603980) has the molecular formula C21H24N2O5-2
and a molecular weight of 384.43 g/mol. Its IUPAC name is 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate.
Molecular Properties
| Compound Name | 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate |
| PubChem CID | 140603980 |
| Molecular Formula | C21H24N2O5-2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate |
| SMILES | CN(C)c1ccc(C2C(=O)C([O-])C(c3ccc(N(C)C)cc3O)C2[O-])c(O)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-22(2)11-5-7-13(15(24)9-11)17-19(26)18(21(28)20(17)27)14-8-6-12(23(3)4)10-16(14)25/h5-10,17-20,24-25H,1-4H3/q-2 |
| InChIKey | HDYVAOZIULYOAT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate?
The IUPAC name of 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate (CID 140603980) is 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate.
What is the SMILES notation for 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate?
The canonical SMILES for 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate is CN(C)c1ccc(C2C(=O)C([O-])C(c3ccc(N(C)C)cc3O)C2[O-])c(O)c1.
What is the InChIKey of 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate?
The InChIKey is HDYVAOZIULYOAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O5/c1-22(2)11-5-7-13(15(24)9-11)17-19(26)18(21(28)20(17)27)14-8-6-12(23(3)4)10-16(14)25/h5-10,17-20,24-25H,1-4H3/q-2.
What are the key properties of 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate?
2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate has a molecular weight of 384.43 g/mol, XLogP of 0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis[4-(dimethylamino)-2-hydroxyphenyl]-5-oxocyclopentane-1,3-diolate is sourced from PubChem (CID 140603980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).