About (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine
(1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine (PubChem CID 140604706) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine |
| PubChem CID | 140604706 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine |
| SMILES | C#CC[C@]1(N)c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C13H15N/c1-3-8-13(14)10(2)9-11-6-4-5-7-12(11)13/h1,4-7,10H,8-9,14H2,2H3/t10-,13-/m1/s1 |
| InChIKey | FWZLEKCAHWGKHO-ZWNOBZJWSA-N |
| XLogP | 2.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine?
The IUPAC name of (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine (CID 140604706) is (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine.
What is the SMILES notation for (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine?
The canonical SMILES for (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine is C#CC[C@]1(N)c2ccccc2C[C@H]1C.
What is the InChIKey of (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine?
The InChIKey is FWZLEKCAHWGKHO-ZWNOBZJWSA-N. The full InChI is InChI=1S/C13H15N/c1-3-8-13(14)10(2)9-11-6-4-5-7-12(11)13/h1,4-7,10H,8-9,14H2,2H3/t10-,13-/m1/s1.
What are the key properties of (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine?
(1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine has a molecular weight of 185.27 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine is sourced from PubChem (CID 140604706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).