C24H18F9NO2 — CID 140606223
N-[5-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]-2,3-dihydro-1H-inden-1-yl]propanamide (PubChem CID 140606223) has the molecular formula C24H18F9NO2 and a molecular weight of 523.40 g/mol. Its IUPAC name is N-[5-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]-2,3-dihydro-1H-inden-1-yl]propanamide.
| Compound Name | N-[5-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]-2,3-dihydro-1H-inden-1-yl]propanamide |
|---|---|
| PubChem CID | 140606223 |
| Molecular Formula | C24H18F9NO2 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | N-[5-[3-[3,5-bis(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enoyl]-2,3-dihydro-1H-inden-1-yl]propanamide |
| SMILES | CCC(=O)NC1CCc2cc(C(=O)C=C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C24H18F9NO2/c1-2-21(36)34-19-6-4-12-7-13(3-5-17(12)19)20(35)11-18(24(31,32)33)14-8-15(22(25,26)27)10-16(9-14)23(28,29)30/h3,5,7-11,19H,2,4,6H2,1H3,(H,34,36) |
| InChIKey | PZCGJPNEJPDWCK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|