About 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione
7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione (PubChem CID 140606578) has the molecular formula C8H9NO5
and a molecular weight of 199.16 g/mol. Its IUPAC name is 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione.
Molecular Properties
| Compound Name | 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione |
| PubChem CID | 140606578 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione |
| SMILES | O=C1OC2(OCC23CCCN3)OC1=O |
| InChI | InChI=1S/C8H9NO5/c10-5-6(11)14-8(13-5)7(4-12-8)2-1-3-9-7/h9H,1-4H2 |
| InChIKey | FGORJIJGBXAEJB-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione?
The IUPAC name of 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione (CID 140606578) is 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione.
What is the SMILES notation for 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione?
The canonical SMILES for 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione is O=C1OC2(OCC23CCCN3)OC1=O.
What is the InChIKey of 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione?
The InChIKey is FGORJIJGBXAEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5/c10-5-6(11)14-8(13-5)7(4-12-8)2-1-3-9-7/h9H,1-4H2.
What are the key properties of 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione?
7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione has a molecular weight of 199.16 g/mol, XLogP of -1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10,11-trioxa-4-azadispiro[4.0.46.25]dodecane-8,9-dione is sourced from PubChem (CID 140606578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).