C21H22F4N6O — CID 140606831
5-[[5-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)-1H-indol-4-yl]-fluoroamino]pyridine-3-carboxamide (PubChem CID 140606831) has the molecular formula C21H22F4N6O and a molecular weight of 450.44 g/mol. Its IUPAC name is 5-[[5-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)-1H-indol-4-yl]-fluoroamino]pyridine-3-carboxamide.
| Compound Name | 5-[[5-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)-1H-indol-4-yl]-fluoroamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140606831 |
| Molecular Formula | C21H22F4N6O |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 5-[[5-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)-1H-indol-4-yl]-fluoroamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(N(F)c2c(NC3CCCCC3N)c(C(F)(F)F)cc3[nH]ccc23)c1 |
| InChI | InChI=1S/C21H22F4N6O/c22-21(23,24)14-8-17-13(5-6-29-17)19(18(14)30-16-4-2-1-3-15(16)26)31(25)12-7-11(20(27)32)9-28-10-12/h5-10,15-16,29-30H,1-4,26H2,(H2,27,32) |
| InChIKey | BENHEIGVAKPGFN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|