C36H68O9Si2 — CID 140607653
[(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] octanoate (PubChem CID 140607653) has the molecular formula C36H68O9Si2 and a molecular weight of 701.10 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 140607653 |
| Molecular Formula | C36H68O9Si2 |
| Molecular Weight | 701.10 g/mol |
| Exact Mass | 700.44 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](CC(CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC)O[C@@]1(OC)C(C)(C)C=O |
| InChI | InChI=1S/C36H68O9Si2/c1-12-19-20-21-22-23-32(38)43-34-29(25-33(39)40-10)24-30(44-36(34,41-11)35(8,9)28-37)26-31(45-47(16-5,17-6)18-7)27-42-46(13-2,14-3)15-4/h25,28,30-31,34H,12-24,26-27H2,1-11H3/b29-25+/t30-,31?,34-,36+/m0/s1 |
| InChIKey | IMULBBUDYJAAGJ-RQSLDALZSA-N |
| XLogP | 8.52 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.10 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|