C19H21N3 — CID 140608199
3-[2-(1,2,3,4-tetrahydropyridin-2-yl)propyl]-1H-pyrido[4,3-b]indole (PubChem CID 140608199) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-[2-(1,2,3,4-tetrahydropyridin-2-yl)propyl]-1H-pyrido[4,3-b]indole.
| Compound Name | 3-[2-(1,2,3,4-tetrahydropyridin-2-yl)propyl]-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 140608199 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-[2-(1,2,3,4-tetrahydropyridin-2-yl)propyl]-1H-pyrido[4,3-b]indole |
| SMILES | CC(CC1=NCC2=c3ccccc3=NC2=C1)C1CCC=CN1 |
| InChI | InChI=1S/C19H21N3/c1-13(17-7-4-5-9-20-17)10-14-11-19-16(12-21-14)15-6-2-3-8-18(15)22-19/h2-3,5-6,8-9,11,13,17,20H,4,7,10,12H2,1H3 |
| InChIKey | POPMHVWIUUPOLI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |