C27H36N2O — CID 140608204
2-pyridin-4-yldocosa-4,7,10,13,16,19-hexaenamide (PubChem CID 140608204) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is 2-pyridin-4-yldocosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | 2-pyridin-4-yldocosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 140608204 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-pyridin-4-yldocosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCC(C(N)=O)c1ccncc1 |
| InChI | InChI=1S/C27H36N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(27(28)30)25-21-23-29-24-22-25/h3-4,6-7,9-10,12-13,15-16,18-19,21-24,26H,2,5,8,11,14,17,20H2,1H3,(H2,28,30) |
| InChIKey | LZAJGIDLTVSGQO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|