C16H36Si2 — CID 140609213
1,1,3,3-tetra(propan-2-yl)-1,3-disilinane (PubChem CID 140609213) has the molecular formula C16H36Si2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 1,1,3,3-tetra(propan-2-yl)-1,3-disilinane.
| Compound Name | 1,1,3,3-tetra(propan-2-yl)-1,3-disilinane |
|---|---|
| PubChem CID | 140609213 |
| Molecular Formula | C16H36Si2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1,1,3,3-tetra(propan-2-yl)-1,3-disilinane |
| SMILES | CC(C)[Si]1(C(C)C)CCC[Si](C(C)C)(C(C)C)C1 |
| InChI | InChI=1S/C16H36Si2/c1-13(2)17(14(3)4)10-9-11-18(12-17,15(5)6)16(7)8/h13-16H,9-12H2,1-8H3 |
| InChIKey | XAZWIDNHETYPRC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|