C32H39O3S+ — CID 140610087
[4-[2-(1-adamantyloxy)-2-oxoethoxy]-3,5-dimethylcyclohexa-1,3-dien-1-yl]-cyclohexa-1,5-dien-1-yl-phenylsulfanium (PubChem CID 140610087) has the molecular formula C32H39O3S+ and a molecular weight of 503.73 g/mol. Its IUPAC name is [4-[2-(1-adamantyloxy)-2-oxoethoxy]-3,5-dimethylcyclohexa-1,3-dien-1-yl]-cyclohexa-1,5-dien-1-yl-phenylsulfanium.
| Compound Name | [4-[2-(1-adamantyloxy)-2-oxoethoxy]-3,5-dimethylcyclohexa-1,3-dien-1-yl]-cyclohexa-1,5-dien-1-yl-phenylsulfanium |
|---|---|
| PubChem CID | 140610087 |
| Molecular Formula | C32H39O3S+ |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | [4-[2-(1-adamantyloxy)-2-oxoethoxy]-3,5-dimethylcyclohexa-1,3-dien-1-yl]-cyclohexa-1,5-dien-1-yl-phenylsulfanium |
| SMILES | CC1=C(OCC(=O)OC23CC4CC(CC(C4)C2)C3)C(C)CC([S+](C2=CCCC=C2)c2ccccc2)=C1 |
| InChI | InChI=1S/C32H39O3S/c1-22-13-29(36(27-9-5-3-6-10-27)28-11-7-4-8-12-28)14-23(2)31(22)34-21-30(33)35-32-18-24-15-25(19-32)17-26(16-24)20-32/h3,5-7,9-13,23-26H,4,8,14-21H2,1-2H3/q+1 |
| InChIKey | ZLSYCFVJIHRWDQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|