C17H20ClF3N2O3 — CID 140610120
[1-(3-chlorobenzoyl)-3,3-diethylpiperazin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140610120) has the molecular formula C17H20ClF3N2O3 and a molecular weight of 392.81 g/mol. Its IUPAC name is [1-(3-chlorobenzoyl)-3,3-diethylpiperazin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(3-chlorobenzoyl)-3,3-diethylpiperazin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140610120 |
| Molecular Formula | C17H20ClF3N2O3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [1-(3-chlorobenzoyl)-3,3-diethylpiperazin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CCC1(CC)NCCN(C(=O)c2cccc(Cl)c2)C1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H20ClF3N2O3/c1-3-16(4-2)14(26-15(25)17(19,20)21)23(9-8-22-16)13(24)11-6-5-7-12(18)10-11/h5-7,10,14,22H,3-4,8-9H2,1-2H3 |
| InChIKey | NXRVDCOJKNBONB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |