C21H27ClO — CID 140611028
2-[2,4-ditert-butyl-6-(chloromethyl)phenyl]phenol (PubChem CID 140611028) has the molecular formula C21H27ClO and a molecular weight of 330.90 g/mol. Its IUPAC name is 2-[2,4-ditert-butyl-6-(chloromethyl)phenyl]phenol.
| Compound Name | 2-[2,4-ditert-butyl-6-(chloromethyl)phenyl]phenol |
|---|---|
| PubChem CID | 140611028 |
| Molecular Formula | C21H27ClO |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[2,4-ditert-butyl-6-(chloromethyl)phenyl]phenol |
| SMILES | CC(C)(C)c1cc(CCl)c(-c2ccccc2O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27ClO/c1-20(2,3)15-11-14(13-22)19(17(12-15)21(4,5)6)16-9-7-8-10-18(16)23/h7-12,23H,13H2,1-6H3 |
| InChIKey | QQVOKAOLBRVCOF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|