About CID 140611509
CID 140611509 (PubChem CID 140611509) has the molecular formula C21H22F3N4O2
and a molecular weight of 419.43 g/mol.
Molecular Properties
| Compound Name | CID 140611509 |
| PubChem CID | 140611509 |
| Molecular Formula | C21H22F3N4O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | — |
| SMILES | N#CC1(C(=O)N2C[C@@H]3CCN(C(=O)C[C@H]([NH])Cc4cc(F)c(F)cc4F)[C@@H]3C2)CC1 |
| InChI | InChI=1S/C21H22F3N4O2/c22-15-8-17(24)16(23)6-13(15)5-14(26)7-19(29)28-4-1-12-9-27(10-18(12)28)20(30)21(11-25)2-3-21/h6,8,12,14,18,26H,1-5,7,9-10H2/t12-,14+,18+/m0/s1 |
| InChIKey | GVANCUCRGYLOFN-WPKBUWHJSA-N |
| XLogP | 2.05 |
| TPSA | 88.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze CID 140611509 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140611509?
The IUPAC name of CID 140611509 (CID 140611509) is not available.
What is the SMILES notation for CID 140611509?
The canonical SMILES for CID 140611509 is N#CC1(C(=O)N2C[C@@H]3CCN(C(=O)C[C@H]([NH])Cc4cc(F)c(F)cc4F)[C@@H]3C2)CC1.
What is the InChIKey of CID 140611509?
The InChIKey is GVANCUCRGYLOFN-WPKBUWHJSA-N. The full InChI is InChI=1S/C21H22F3N4O2/c22-15-8-17(24)16(23)6-13(15)5-14(26)7-19(29)28-4-1-12-9-27(10-18(12)28)20(30)21(11-25)2-3-21/h6,8,12,14,18,26H,1-5,7,9-10H2/t12-,14+,18+/m0/s1.
What are the key properties of CID 140611509?
CID 140611509 has a molecular weight of 419.43 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140611509 is sourced from PubChem (CID 140611509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).