About CID 140611533
CID 140611533 (PubChem CID 140611533) has the molecular formula C18H21F3N3O2
and a molecular weight of 368.38 g/mol.
Molecular Properties
| Compound Name | CID 140611533 |
| PubChem CID | 140611533 |
| Molecular Formula | C18H21F3N3O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | — |
| SMILES | CC(=O)N1C[C@@H]2CCN(C(=O)C[C@H]([NH])Cc3cc(F)c(F)cc3F)[C@@H]2C1 |
| InChI | InChI=1S/C18H21F3N3O2/c1-10(25)23-8-11-2-3-24(17(11)9-23)18(26)6-13(22)4-12-5-15(20)16(21)7-14(12)19/h5,7,11,13,17,22H,2-4,6,8-9H2,1H3/t11-,13+,17+/m0/s1 |
| InChIKey | FLAHABJLWWOEGB-XTQGRXLLSA-N |
| XLogP | 1.77 |
| TPSA | 64.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze CID 140611533 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140611533?
The IUPAC name of CID 140611533 (CID 140611533) is not available.
What is the SMILES notation for CID 140611533?
The canonical SMILES for CID 140611533 is CC(=O)N1C[C@@H]2CCN(C(=O)C[C@H]([NH])Cc3cc(F)c(F)cc3F)[C@@H]2C1.
What is the InChIKey of CID 140611533?
The InChIKey is FLAHABJLWWOEGB-XTQGRXLLSA-N. The full InChI is InChI=1S/C18H21F3N3O2/c1-10(25)23-8-11-2-3-24(17(11)9-23)18(26)6-13(22)4-12-5-15(20)16(21)7-14(12)19/h5,7,11,13,17,22H,2-4,6,8-9H2,1H3/t11-,13+,17+/m0/s1.
What are the key properties of CID 140611533?
CID 140611533 has a molecular weight of 368.38 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140611533 is sourced from PubChem (CID 140611533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).