C33H35ClN4O6S — CID 140611704
5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-methoxy-3-pyridinyl)-2H-indole (PubChem CID 140611704) has the molecular formula C33H35ClN4O6S and a molecular weight of 651.19 g/mol. Its IUPAC name is 5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-methoxy-3-pyridinyl)-2H-indole.
| Compound Name | 5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-methoxy-3-pyridinyl)-2H-indole |
|---|---|
| PubChem CID | 140611704 |
| Molecular Formula | C33H35ClN4O6S |
| Molecular Weight | 651.19 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-methoxy-3-pyridinyl)-2H-indole |
| SMILES | COc1ccc(N2CCN(C3(c4cccnc4OC)CN(S(=O)(=O)c4ccc(OC)cc4OC)c4ccc(Cl)cc43)CC2)cc1 |
| InChI | InChI=1S/C33H35ClN4O6S/c1-41-25-10-8-24(9-11-25)36-16-18-37(19-17-36)33(27-6-5-15-35-32(27)44-4)22-38(29-13-7-23(34)20-28(29)33)45(39,40)31-14-12-26(42-2)21-30(31)43-3/h5-15,20-21H,16-19,22H2,1-4H3 |
| InChIKey | MVXHZIVMKOXTPG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.19 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|