About (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium
(4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium (PubChem CID 140611921) has the molecular formula C9H20NO+
and a molecular weight of 158.26 g/mol. Its IUPAC name is (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium.
Molecular Properties
| Compound Name | (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium |
| PubChem CID | 140611921 |
| Molecular Formula | C9H20NO+ |
| Molecular Weight | 158.26 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium |
| SMILES | CCO[C@@H]1CC[NH2+]CC1(C)C |
| InChI | InChI=1S/C9H19NO/c1-4-11-8-5-6-10-7-9(8,2)3/h8,10H,4-7H2,1-3H3/p+1/t8-/m1/s1 |
| InChIKey | OZASUIICEWISRM-MRVPVSSYSA-O |
| XLogP | 0.38 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium?
The IUPAC name of (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium (CID 140611921) is (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium.
What is the SMILES notation for (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium?
The canonical SMILES for (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium is CCO[C@@H]1CC[NH2+]CC1(C)C.
What is the InChIKey of (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium?
The InChIKey is OZASUIICEWISRM-MRVPVSSYSA-O. The full InChI is InChI=1S/C9H19NO/c1-4-11-8-5-6-10-7-9(8,2)3/h8,10H,4-7H2,1-3H3/p+1/t8-/m1/s1.
What are the key properties of (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium?
(4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium has a molecular weight of 158.26 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-ethoxy-3,3-dimethylpiperidin-1-ium is sourced from PubChem (CID 140611921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).