C20H21F2NaO14S — CID 140612201
sodium [7-[(2S,4S,5R)-3,4-dihydroxy-5-[(2S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6,8-difluoro-2-oxochromen-4-yl]methanesulfonate (PubChem CID 140612201) has the molecular formula C20H21F2NaO14S and a molecular weight of 578.43 g/mol. Its IUPAC name is sodium [7-[(2S,4S,5R)-3,4-dihydroxy-5-[(2S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6,8-difluoro-2-oxochromen-4-yl]methanesulfonate.
| Compound Name | sodium [7-[(2S,4S,5R)-3,4-dihydroxy-5-[(2S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6,8-difluoro-2-oxochromen-4-yl]methanesulfonate |
|---|---|
| PubChem CID | 140612201 |
| Molecular Formula | C20H21F2NaO14S |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | sodium [7-[(2S,4S,5R)-3,4-dihydroxy-5-[(2S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6,8-difluoro-2-oxochromen-4-yl]methanesulfonate |
| SMILES | O=c1cc(CS(=O)(=O)[O-])c2cc(F)c(O[C@@H]3OC[C@@H](O[C@@H]4OC[C@@H](O)[C@@H](O)C4O)[C@@H](O)C3O)c(F)c2o1.[Na+] |
| InChI | InChI=1S/C20H22F2O14S.Na/c21-8-2-7-6(5-37(29,30)31)1-11(24)35-17(7)12(22)18(8)36-20-16(28)14(26)10(4-33-20)34-19-15(27)13(25)9(23)3-32-19;/h1-2,9-10,13-16,19-20,23,25-28H,3-5H2,(H,29,30,31);/q;+1/p-1/t9-,10-,13-,14-,15?,16?,19+,20+;/m1./s1 |
| InChIKey | PJYULCRBBWEUFO-VZSNGUSXSA-M |
| XLogP | -5.60 |
| TPSA | 225.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|