C20H34O2 — CID 14061227
(4'S,4'aS,8'aS)-4',8'a-dimethyl-4'-(4-methylpent-3-enyl)spiro[1,3-dioxolane-2,8'-2,3,4a,5,6,7-hexahydro-1H-naphthalene] (PubChem CID 14061227) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (4'S,4'aS,8'aS)-4',8'a-dimethyl-4'-(4-methylpent-3-enyl)spiro[1,3-dioxolane-2,8'-2,3,4a,5,6,7-hexahydro-1H-naphthalene].
| Compound Name | (4'S,4'aS,8'aS)-4',8'a-dimethyl-4'-(4-methylpent-3-enyl)spiro[1,3-dioxolane-2,8'-2,3,4a,5,6,7-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 14061227 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (4'S,4'aS,8'aS)-4',8'a-dimethyl-4'-(4-methylpent-3-enyl)spiro[1,3-dioxolane-2,8'-2,3,4a,5,6,7-hexahydro-1H-naphthalene] |
| SMILES | CC(C)=CCC[C@]1(C)CCC[C@@]2(C)[C@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C20H34O2/c1-16(2)8-5-10-18(3)11-7-12-19(4)17(18)9-6-13-20(19)21-14-15-22-20/h8,17H,5-7,9-15H2,1-4H3/t17-,18+,19-/m0/s1 |
| InChIKey | NNNJBVICGSMWIP-OTWHNJEPSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|