C20H32O3 — CID 14061231
methyl (4aS,5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1-oxo-3,4,4a,6,7,8-hexahydro-2H-naphthalene-2-carboxylate (PubChem CID 14061231) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is methyl (4aS,5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1-oxo-3,4,4a,6,7,8-hexahydro-2H-naphthalene-2-carboxylate.
| Compound Name | methyl (4aS,5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1-oxo-3,4,4a,6,7,8-hexahydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 14061231 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | methyl (4aS,5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-1-oxo-3,4,4a,6,7,8-hexahydro-2H-naphthalene-2-carboxylate |
| SMILES | COC(=O)C1CC[C@H]2[C@](C)(CCC=C(C)C)CCC[C@]2(C)C1=O |
| InChI | InChI=1S/C20H32O3/c1-14(2)8-6-11-19(3)12-7-13-20(4)16(19)10-9-15(17(20)21)18(22)23-5/h8,15-16H,6-7,9-13H2,1-5H3/t15?,16-,19+,20-/m0/s1 |
| InChIKey | JRJJWSRANBMWST-HKPCIYPDSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|