C45H56Cl2N3O2Ru- — CID 140613131
(4-benzoyl-2-ethyl-2,3-dihydro-1,4-benzoxazin-8-yl)methylidene-dichlororuthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide (PubChem CID 140613131) has the molecular formula C45H56Cl2N3O2Ru- and a molecular weight of 842.94 g/mol. Its IUPAC name is (4-benzoyl-2-ethyl-2,3-dihydro-1,4-benzoxazin-8-yl)methylidene-dichlororuthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide.
| Compound Name | (4-benzoyl-2-ethyl-2,3-dihydro-1,4-benzoxazin-8-yl)methylidene-dichlororuthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide |
|---|---|
| PubChem CID | 140613131 |
| Molecular Formula | C45H56Cl2N3O2Ru- |
| Molecular Weight | 842.94 g/mol |
| Exact Mass | 842.28 |
| IUPAC Name | (4-benzoyl-2-ethyl-2,3-dihydro-1,4-benzoxazin-8-yl)methylidene-dichlororuthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[CH-]N(c2c(C(C)C)cccc2C(C)C)CC1.CCC1CN(C(=O)c2ccccc2)c2cccc(C=[Ru](Cl)Cl)c2O1 |
| InChI | InChI=1S/C27H39N2.C18H17NO2.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-3-15-12-19(18(20)14-9-5-4-6-10-14)16-11-7-8-13(2)17(16)21-15;;;/h9-14,17-21H,15-16H2,1-8H3;2,4-11,15H,3,12H2,1H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | MSDQDGIYKHHOSL-UHFFFAOYSA-L |
| XLogP | 12.21 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.94 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|