C22H23F4NO5S — CID 140613298
[6-ethyl-2-(2-fluoropropoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate (PubChem CID 140613298) has the molecular formula C22H23F4NO5S and a molecular weight of 489.49 g/mol. Its IUPAC name is [6-ethyl-2-(2-fluoropropoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate.
| Compound Name | [6-ethyl-2-(2-fluoropropoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140613298 |
| Molecular Formula | C22H23F4NO5S |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [6-ethyl-2-(2-fluoropropoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate |
| SMILES | CCN1CCc2cc(OCC(C)F)cc3c2C1Cc1ccc(OS(=O)(=O)C(F)(F)F)c(O)c1-3 |
| InChI | InChI=1S/C22H23F4NO5S/c1-3-27-7-6-14-8-15(31-11-12(2)23)10-16-19(14)17(27)9-13-4-5-18(21(28)20(13)16)32-33(29,30)22(24,25)26/h4-5,8,10,12,17,28H,3,6-7,9,11H2,1-2H3 |
| InChIKey | KULOSJJDOIFNNP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|