C11H21N3O3S — CID 140613305
N-[2-(2-oxoimidazolidin-1-yl)ethyl]cyclohexanesulfonamide (PubChem CID 140613305) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-[2-(2-oxoimidazolidin-1-yl)ethyl]cyclohexanesulfonamide.
| Compound Name | N-[2-(2-oxoimidazolidin-1-yl)ethyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 140613305 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[2-(2-oxoimidazolidin-1-yl)ethyl]cyclohexanesulfonamide |
| SMILES | O=C1NCCN1CCNS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H21N3O3S/c15-11-12-6-8-14(11)9-7-13-18(16,17)10-4-2-1-3-5-10/h10,13H,1-9H2,(H,12,15) |
| InChIKey | HKVPMIOJFIPSJI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |