C31H39ClN4O5 — CID 140613331
ethyl 2-[2-chloro-4-[(3R)-4-[6-[[(1R,3R)-5-hydroxy-2-adamantyl]carbamoyl]-2-pyridinyl]-3-methylpiperazin-1-yl]phenoxy]acetate (PubChem CID 140613331) has the molecular formula C31H39ClN4O5 and a molecular weight of 583.13 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(3R)-4-[6-[[(1R,3R)-5-hydroxy-2-adamantyl]carbamoyl]-2-pyridinyl]-3-methylpiperazin-1-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(3R)-4-[6-[[(1R,3R)-5-hydroxy-2-adamantyl]carbamoyl]-2-pyridinyl]-3-methylpiperazin-1-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 140613331 |
| Molecular Formula | C31H39ClN4O5 |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(3R)-4-[6-[[(1R,3R)-5-hydroxy-2-adamantyl]carbamoyl]-2-pyridinyl]-3-methylpiperazin-1-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(N2CCN(c3cccc(C(=O)NC4[C@@H]5CC6C[C@@H]4CC(O)(C6)C5)n3)[C@H](C)C2)cc1Cl |
| InChI | InChI=1S/C31H39ClN4O5/c1-3-40-28(37)18-41-26-8-7-23(13-24(26)32)35-9-10-36(19(2)17-35)27-6-4-5-25(33-27)30(38)34-29-21-11-20-12-22(29)16-31(39,14-20)15-21/h4-8,13,19-22,29,39H,3,9-12,14-18H2,1-2H3,(H,34,38)/t19-,20?,21-,22-,29?,31?/m1/s1 |
| InChIKey | UIZDMPKHEIVWIG-XNUCNRFTSA-N |
| XLogP | 4.06 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|