C15H18F8NO7S- — CID 140614037
2-[3-[di(propan-2-yl)amino]-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1-difluoroethanesulfonate (PubChem CID 140614037) has the molecular formula C15H18F8NO7S- and a molecular weight of 508.36 g/mol. Its IUPAC name is 2-[3-[di(propan-2-yl)amino]-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[3-[di(propan-2-yl)amino]-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140614037 |
| Molecular Formula | C15H18F8NO7S- |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 2-[3-[di(propan-2-yl)amino]-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1-difluoroethanesulfonate |
| SMILES | C=C(C(=O)OC(OCC(F)(F)S(=O)(=O)[O-])(C(=O)N(C(C)C)C(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H19F8NO7S/c1-7(2)24(8(3)4)11(26)13(15(21,22)23,30-6-12(16,17)32(27,28)29)31-10(25)9(5)14(18,19)20/h7-8H,5-6H2,1-4H3,(H,27,28,29)/p-1 |
| InChIKey | IGHWDYPJMODDDN-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|