C13H18O5 — CID 14061412
ethyl (3aR,6aS)-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-1-carboxylate (PubChem CID 14061412) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is ethyl (3aR,6aS)-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-1-carboxylate.
| Compound Name | ethyl (3aR,6aS)-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-1-carboxylate |
|---|---|
| PubChem CID | 14061412 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl (3aR,6aS)-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C[C@@H]2CC3(C[C@H]12)OCCO3 |
| InChI | InChI=1S/C13H18O5/c1-2-16-12(15)11-9-7-13(17-3-4-18-13)6-8(9)5-10(11)14/h8-9,11H,2-7H2,1H3/t8-,9+,11?/m1/s1 |
| InChIKey | FNZJLBRFBMALLN-VFXVZZSQSA-N |
| XLogP | 0.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|