C14H17F5NO7S- — CID 140614284
1,1-difluoro-2-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxyethanesulfonate (PubChem CID 140614284) has the molecular formula C14H17F5NO7S- and a molecular weight of 438.35 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxyethanesulfonate |
|---|---|
| PubChem CID | 140614284 |
| Molecular Formula | C14H17F5NO7S- |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxyethanesulfonate |
| SMILES | C=C(C)C(=O)OC(OCC(F)(F)S(=O)(=O)[O-])(C(=O)N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H18F5NO7S/c1-9(2)10(21)27-13(14(17,18)19,11(22)20-6-4-3-5-7-20)26-8-12(15,16)28(23,24)25/h1,3-8H2,2H3,(H,23,24,25)/p-1 |
| InChIKey | FEMLXIAWFMQPEN-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|