C14H14F8NO7S- — CID 140614558
1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-piperidin-1-yl-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate (PubChem CID 140614558) has the molecular formula C14H14F8NO7S- and a molecular weight of 492.32 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-piperidin-1-yl-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-piperidin-1-yl-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate |
|---|---|
| PubChem CID | 140614558 |
| Molecular Formula | C14H14F8NO7S- |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-piperidin-1-yl-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate |
| SMILES | C=C(C(=O)OC(OCC(F)(F)S(=O)(=O)[O-])(C(=O)N1CCCCC1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F8NO7S/c1-8(13(17,18)19)9(24)30-12(14(20,21)22,10(25)23-5-3-2-4-6-23)29-7-11(15,16)31(26,27)28/h1-7H2,(H,26,27,28)/p-1 |
| InChIKey | LRZJXORNQLGDHI-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|