C17H21F7NO7S- — CID 140614712
1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxypentane-1-sulfonate (PubChem CID 140614712) has the molecular formula C17H21F7NO7S- and a molecular weight of 516.41 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxypentane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxypentane-1-sulfonate |
|---|---|
| PubChem CID | 140614712 |
| Molecular Formula | C17H21F7NO7S- |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-piperidin-1-ylpropan-2-yl]oxypentane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C17H22F7NO7S/c1-11(2)12(26)32-15(16(20,21)22,13(27)25-8-4-3-5-9-25)31-10-6-7-14(18,19)17(23,24)33(28,29)30/h1,3-10H2,2H3,(H,28,29,30)/p-1 |
| InChIKey | ZRWDKWTXVZRXMO-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|