C25H44O4SSi — CID 14061495
[(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-6-phenylsulfanylhexyl] 2,2-dimethylpropanoate (PubChem CID 14061495) has the molecular formula C25H44O4SSi and a molecular weight of 468.78 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-6-phenylsulfanylhexyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-6-phenylsulfanylhexyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14061495 |
| Molecular Formula | C25H44O4SSi |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyl-6-phenylsulfanylhexyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COC(=O)C(C)(C)C)[C@@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C25H44O4SSi/c1-18(16-28-23(27)24(3,4)5)22(29-31(9,10)25(6,7)8)19(2)21(26)17-30-20-14-12-11-13-15-20/h11-15,18-19,21-22,26H,16-17H2,1-10H3/t18-,19-,21-,22+/m0/s1 |
| InChIKey | FNJHZCPMDBWIOD-BLKABHOGSA-N |
| XLogP | 6.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|