C29H44N4O4SSi — CID 140616019
tert-butyl N-[4-[[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-isocyanoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]cyclohexyl]carbamate (PubChem CID 140616019) has the molecular formula C29H44N4O4SSi and a molecular weight of 572.85 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-isocyanoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-isocyanoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 140616019 |
| Molecular Formula | C29H44N4O4SSi |
| Molecular Weight | 572.85 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | tert-butyl N-[4-[[(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-isocyanoethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]cyclohexyl]carbamate |
| SMILES | [C-]#[N+]C(C[C@H]1CCc2sc3ncnc(OC4CCC(NC(=O)OC(C)(C)C)CC4)c3c21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H44N4O4SSi/c1-28(2,3)36-27(34)33-19-11-13-20(14-12-19)35-25-24-23-18(10-15-21(23)38-26(24)32-17-31-25)16-22(30-7)37-39(8,9)29(4,5)6/h17-20,22H,10-16H2,1-6,8-9H3,(H,33,34)/t18-,19?,20?,22?/m1/s1 |
| InChIKey | BTWBRIFOLJZSGY-USFHKRFISA-N |
| XLogP | 7.59 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.85 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|