About N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide
N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide (PubChem CID 140616035) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 140616035 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide |
| SMILES | [C-]#[N+]c1cccc2c1CC[C@H]2NS(=O)C(C)(C)C |
| InChI | InChI=1S/C14H18N2OS/c1-14(2,3)18(17)16-13-9-8-11-10(13)6-5-7-12(11)15-4/h5-7,13,16H,8-9H2,1-3H3/t13-,18?/m1/s1 |
| InChIKey | BLYQOXKZUATWME-YJJYDOSJSA-N |
| XLogP | 3.28 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide (CID 140616035) is N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide is [C-]#[N+]c1cccc2c1CC[C@H]2NS(=O)C(C)(C)C.
What is the InChIKey of N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is BLYQOXKZUATWME-YJJYDOSJSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-14(2,3)18(17)16-13-9-8-11-10(13)6-5-7-12(11)15-4/h5-7,13,16H,8-9H2,1-3H3/t13-,18?/m1/s1.
What are the key properties of N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide?
N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 262.38 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-4-isocyano-2,3-dihydro-1H-inden-1-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 140616035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).