2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride

C4H4F2O5S2 — CID 140617188

IUPAC2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride
SMILESO=S(=O)(F)C=COC=CS(=O)(=O)F
InChIInChI=1S/C4H4F2O5S2/c5-12(7,8)3-1-11-2-4-13(6,9)10/h1-4H
InChIKeyHFRIXTKLVQGIDS-UHFFFAOYSA-N
MW234.20 g/mol
LogP0.54
Rot. Bonds4

About 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride

2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride (PubChem CID 140617188) has the molecular formula C4H4F2O5S2 and a molecular weight of 234.20 g/mol. Its IUPAC name is 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride.

Molecular Properties

Compound Name2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride
PubChem CID140617188
Molecular FormulaC4H4F2O5S2
Molecular Weight234.20 g/mol
Exact Mass233.95
IUPAC Name2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride
SMILESO=S(=O)(F)C=COC=CS(=O)(=O)F
InChIInChI=1S/C4H4F2O5S2/c5-12(7,8)3-1-11-2-4-13(6,9)10/h1-4H
InChIKeyHFRIXTKLVQGIDS-UHFFFAOYSA-N
XLogP0.54
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.20
LogP ≤ 50.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}

Analyze 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride?
The IUPAC name of 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride (CID 140617188) is 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride.
What is the SMILES notation for 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride?
The canonical SMILES for 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride is O=S(=O)(F)C=COC=CS(=O)(=O)F.
What is the InChIKey of 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride?
The InChIKey is HFRIXTKLVQGIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F2O5S2/c5-12(7,8)3-1-11-2-4-13(6,9)10/h1-4H.
What are the key properties of 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride?
2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride has a molecular weight of 234.20 g/mol, XLogP of 0.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorosulfonylethenoxy)ethenesulfonyl fluoride is sourced from PubChem (CID 140617188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).