C10H20N4O4S — CID 140617253
N'-[2-(azocan-1-yl)ethyl]-2,2-dioxo-1,3,2,4-dioxathiazetidine-4-carboximidamide (PubChem CID 140617253) has the molecular formula C10H20N4O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is N'-[2-(azocan-1-yl)ethyl]-2,2-dioxo-1,3,2,4-dioxathiazetidine-4-carboximidamide.
| Compound Name | N'-[2-(azocan-1-yl)ethyl]-2,2-dioxo-1,3,2,4-dioxathiazetidine-4-carboximidamide |
|---|---|
| PubChem CID | 140617253 |
| Molecular Formula | C10H20N4O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N'-[2-(azocan-1-yl)ethyl]-2,2-dioxo-1,3,2,4-dioxathiazetidine-4-carboximidamide |
| SMILES | N/C(=N\CCN1CCCCCCC1)N1OS(=O)(=O)O1 |
| InChI | InChI=1S/C10H20N4O4S/c11-10(14-17-19(15,16)18-14)12-6-9-13-7-4-2-1-3-5-8-13/h1-9H2,(H2,11,12) |
| InChIKey | DKCOVNPGEUEZRJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|