About 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium
1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium (PubChem CID 140617670) has the molecular formula C15H25S+
and a molecular weight of 237.43 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium.
Molecular Properties
| Compound Name | 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium |
| PubChem CID | 140617670 |
| Molecular Formula | C15H25S+ |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium |
| SMILES | CC(C)(C)C1=CC=C([S+]2CCCCC2)CC1 |
| InChI | InChI=1S/C15H25S/c1-15(2,3)13-7-9-14(10-8-13)16-11-5-4-6-12-16/h7,9H,4-6,8,10-12H2,1-3H3/q+1 |
| InChIKey | ITADACPEHVCKHD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium?
The IUPAC name of 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium (CID 140617670) is 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium.
What is the SMILES notation for 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium?
The canonical SMILES for 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium is CC(C)(C)C1=CC=C([S+]2CCCCC2)CC1.
What is the InChIKey of 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium?
The InChIKey is ITADACPEHVCKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25S/c1-15(2,3)13-7-9-14(10-8-13)16-11-5-4-6-12-16/h7,9H,4-6,8,10-12H2,1-3H3/q+1.
What are the key properties of 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium?
1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium has a molecular weight of 237.43 g/mol, XLogP of 4.44, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)thian-1-ium is sourced from PubChem (CID 140617670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).