C29H17F4N5 — CID 140617931
3,4-bis[1-(2,4-difluorophenyl)pyrazol-3-yl]-2-phenylpyridine (PubChem CID 140617931) has the molecular formula C29H17F4N5 and a molecular weight of 511.48 g/mol. Its IUPAC name is 3,4-bis[1-(2,4-difluorophenyl)pyrazol-3-yl]-2-phenylpyridine.
| Compound Name | 3,4-bis[1-(2,4-difluorophenyl)pyrazol-3-yl]-2-phenylpyridine |
|---|---|
| PubChem CID | 140617931 |
| Molecular Formula | C29H17F4N5 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 3,4-bis[1-(2,4-difluorophenyl)pyrazol-3-yl]-2-phenylpyridine |
| SMILES | Fc1ccc(-n2ccc(-c3ccnc(-c4ccccc4)c3-c3ccn(-c4ccc(F)cc4F)n3)n2)c(F)c1 |
| InChI | InChI=1S/C29H17F4N5/c30-19-6-8-26(22(32)16-19)37-14-11-24(35-37)21-10-13-34-29(18-4-2-1-3-5-18)28(21)25-12-15-38(36-25)27-9-7-20(31)17-23(27)33/h1-17H |
| InChIKey | MUEVFUZRKKMCPO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |