About 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide
3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide (PubChem CID 140618607) has the molecular formula C19H22N4O3Se
and a molecular weight of 433.37 g/mol. Its IUPAC name is 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide |
| PubChem CID | 140618607 |
| Molecular Formula | C19H22N4O3Se |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide |
| SMILES | CC(C)(C)c1cc(Nc2ncnc3cc(CO)c(CO)cc23)c(C(N)=O)[se]1 |
| InChI | InChI=1S/C19H22N4O3Se/c1-19(2,3)15-6-14(16(27-15)17(20)26)23-18-12-4-10(7-24)11(8-25)5-13(12)21-9-22-18/h4-6,9,24-25H,7-8H2,1-3H3,(H2,20,26)(H,21,22,23) |
| InChIKey | XPPSDKIQJKXDJT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide?
The IUPAC name of 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide (CID 140618607) is 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide.
What is the SMILES notation for 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide?
The canonical SMILES for 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide is CC(C)(C)c1cc(Nc2ncnc3cc(CO)c(CO)cc23)c(C(N)=O)[se]1.
What is the InChIKey of 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide?
The InChIKey is XPPSDKIQJKXDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O3Se/c1-19(2,3)15-6-14(16(27-15)17(20)26)23-18-12-4-10(7-24)11(8-25)5-13(12)21-9-22-18/h4-6,9,24-25H,7-8H2,1-3H3,(H2,20,26)(H,21,22,23).
What are the key properties of 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide?
3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide has a molecular weight of 433.37 g/mol, XLogP of 1.81, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-5-tert-butylselenophene-2-carboxamide is sourced from PubChem (CID 140618607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).