About ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate
ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate (PubChem CID 14062055) has the molecular formula C10H17F3O2S
and a molecular weight of 258.30 g/mol. Its IUPAC name is ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate |
| PubChem CID | 14062055 |
| Molecular Formula | C10H17F3O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate |
| SMILES | CCCCSC(CC(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O2S/c1-3-5-6-16-8(10(11,12)13)7-9(14)15-4-2/h8H,3-7H2,1-2H3 |
| InChIKey | RRFFYRHKXYEJLL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate?
The IUPAC name of ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate (CID 14062055) is ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate.
What is the SMILES notation for ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate?
The canonical SMILES for ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate is CCCCSC(CC(=O)OCC)C(F)(F)F.
What is the InChIKey of ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate?
The InChIKey is RRFFYRHKXYEJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O2S/c1-3-5-6-16-8(10(11,12)13)7-9(14)15-4-2/h8H,3-7H2,1-2H3.
What are the key properties of ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate?
ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate has a molecular weight of 258.30 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-butylsulfanyl-4,4,4-trifluorobutanoate is sourced from PubChem (CID 14062055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).